About 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine
2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine (PubChem CID 90243433) has the molecular formula C5H16N4
and a molecular weight of 132.21 g/mol. Its IUPAC name is 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine |
| PubChem CID | 90243433 |
| Molecular Formula | C5H16N4 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.14 |
| IUPAC Name | 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine |
| SMILES | CCNNCNN(C)C |
| InChI | InChI=1S/C5H16N4/c1-4-6-7-5-8-9(2)3/h6-8H,4-5H2,1-3H3 |
| InChIKey | HZPNZXFYDFVKII-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine?
The IUPAC name of 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine (CID 90243433) is 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine.
What is the SMILES notation for 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine?
The canonical SMILES for 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine is CCNNCNN(C)C.
What is the InChIKey of 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine?
The InChIKey is HZPNZXFYDFVKII-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H16N4/c1-4-6-7-5-8-9(2)3/h6-8H,4-5H2,1-3H3.
What are the key properties of 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine?
2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine has a molecular weight of 132.21 g/mol, XLogP of -0.88, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-ethylhydrazinyl)methyl]-1,1-dimethylhydrazine is sourced from PubChem (CID 90243433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).