About (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine
(3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine (PubChem CID 90243508) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine.
Molecular Properties
| Compound Name | (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine |
| PubChem CID | 90243508 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C(/C=C(\C=C)C1CC1)\C=N\[H] |
| InChI | InChI=1S/C9H12N2/c1-2-7(8-3-4-8)5-9(11)6-10/h2,5-6,8,10-11H,1,3-4H2/b7-5+,10-6+,11-9- |
| InChIKey | FMQCITXJARPUNC-WCODZHKHSA-N |
| XLogP | 2.18 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine?
The IUPAC name of (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine (CID 90243508) is (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine.
What is the SMILES notation for (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine?
The canonical SMILES for (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine is [H]/N=C(/C=C(\C=C)C1CC1)\C=N\[H].
What is the InChIKey of (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine?
The InChIKey is FMQCITXJARPUNC-WCODZHKHSA-N. The full InChI is InChI=1S/C9H12N2/c1-2-7(8-3-4-8)5-9(11)6-10/h2,5-6,8,10-11H,1,3-4H2/b7-5+,10-6+,11-9-.
What are the key properties of (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine?
(3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine has a molecular weight of 148.21 g/mol, XLogP of 2.18, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-cyclopropylhexa-3,5-diene-1,2-diimine is sourced from PubChem (CID 90243508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).