C18H26N2O — CID 90243737
12,12,14,14-tetramethyl-1,8-diazatricyclo[8.6.0.02,7]hexadeca-2,4,6-trien-9-one (PubChem CID 90243737) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 12,12,14,14-tetramethyl-1,8-diazatricyclo[8.6.0.02,7]hexadeca-2,4,6-trien-9-one.
| Compound Name | 12,12,14,14-tetramethyl-1,8-diazatricyclo[8.6.0.02,7]hexadeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 90243737 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 12,12,14,14-tetramethyl-1,8-diazatricyclo[8.6.0.02,7]hexadeca-2,4,6-trien-9-one |
| SMILES | CC1(C)CCN2c3ccccc3NC(=O)C2CC(C)(C)C1 |
| InChI | InChI=1S/C18H26N2O/c1-17(2)9-10-20-14-8-6-5-7-13(14)19-16(21)15(20)11-18(3,4)12-17/h5-8,15H,9-12H2,1-4H3,(H,19,21) |
| InChIKey | GXAWAMBBDFMRGY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |