About 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one
6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one (PubChem CID 90243738) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one.
Molecular Properties
| Compound Name | 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one |
| PubChem CID | 90243738 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one |
| SMILES | CC1CC=Cc2c1[nH]c(=O)c1nccn21 |
| InChI | InChI=1S/C11H11N3O/c1-7-3-2-4-8-9(7)13-11(15)10-12-5-6-14(8)10/h2,4-7H,3H2,1H3,(H,13,15) |
| InChIKey | UDDFCSMRWRZBFD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one?
The IUPAC name of 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one (CID 90243738) is 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one.
What is the SMILES notation for 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one?
The canonical SMILES for 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one is CC1CC=Cc2c1[nH]c(=O)c1nccn21.
What is the InChIKey of 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one?
The InChIKey is UDDFCSMRWRZBFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O/c1-7-3-2-4-8-9(7)13-11(15)10-12-5-6-14(8)10/h2,4-7H,3H2,1H3,(H,13,15).
What are the key properties of 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one?
6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one has a molecular weight of 201.23 g/mol, XLogP of 1.54, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-6,7-dihydro-5H-imidazo[1,2-a]quinoxalin-4-one is sourced from PubChem (CID 90243738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).