C18H23N3O2 — CID 90243803
(1S,3S,5S)-2-[(1R,2S,5R,9R)-7-hydroxy-3-azatetracyclo[5.3.1.15,9.01,4]dodecane-2-carbonyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile (PubChem CID 90243803) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (1S,3S,5S)-2-[(1R,2S,5R,9R)-7-hydroxy-3-azatetracyclo[5.3.1.15,9.01,4]dodecane-2-carbonyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile.
| Compound Name | (1S,3S,5S)-2-[(1R,2S,5R,9R)-7-hydroxy-3-azatetracyclo[5.3.1.15,9.01,4]dodecane-2-carbonyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile |
|---|---|
| PubChem CID | 90243803 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (1S,3S,5S)-2-[(1R,2S,5R,9R)-7-hydroxy-3-azatetracyclo[5.3.1.15,9.01,4]dodecane-2-carbonyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile |
| SMILES | N#C[C@@H]1C[C@@H]2C[C@@H]2N1C(=O)[C@H]1NC2[C@@H]3C[C@H]4CC(O)(C3)C[C@]21C4 |
| InChI | InChI=1S/C18H23N3O2/c19-7-12-2-10-3-13(10)21(12)16(22)15-18-5-9-1-11(14(18)20-15)6-17(23,4-9)8-18/h9-15,20,23H,1-6,8H2/t9-,10+,11+,12-,13-,14?,15+,17?,18+/m0/s1 |
| InChIKey | QOYPEZYDIMJDCU-JQNUJVFFSA-N |
| XLogP | 0.78 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |