C19H28O3Si — CID 90243908
cis-methyl (1R,2S)-1-ethynyl-3,3-dimethyl-6-oxo-2-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate (PubChem CID 90243908) has the molecular formula C19H28O3Si and a molecular weight of 332.52 g/mol. Its IUPAC name is cis-methyl (1R,2S)-1-ethynyl-3,3-dimethyl-6-oxo-2-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate.
| Compound Name | cis-methyl (1R,2S)-1-ethynyl-3,3-dimethyl-6-oxo-2-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90243908 |
| Molecular Formula | C19H28O3Si |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | cis-methyl (1R,2S)-1-ethynyl-3,3-dimethyl-6-oxo-2-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate |
| SMILES | C#C[C@@]1(C(=O)OC)C(=O)CCC(C)(C)[C@@H]1CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C19H28O3Si/c1-8-19(17(21)22-4)15(11-9-10-14-23(5,6)7)18(2,3)13-12-16(19)20/h1,15H,9,11-13H2,2-7H3/t15-,19-/m0/s1 |
| InChIKey | VTSXLXXUXWVUGM-KXBFYZLASA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|