C9H14N2 — CID 90243951
4-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-2,3-dihydro-1H-imidazole (PubChem CID 90243951) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 4-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-2,3-dihydro-1H-imidazole.
| Compound Name | 4-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-2,3-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 90243951 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 4-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-2,3-dihydro-1H-imidazole |
| SMILES | C/C=C\C=C/C1NC=C(C)N1 |
| InChI | InChI=1S/C9H14N2/c1-3-4-5-6-9-10-7-8(2)11-9/h3-7,9-11H,1-2H3/b4-3-,6-5- |
| InChIKey | YWQPMNBGTDYQHA-OUPQRBNQSA-N |
| XLogP | 1.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|