About CID 90244066
CID 90244066 (PubChem CID 90244066) has the molecular formula C5H8BFO3S
and a molecular weight of 177.99 g/mol.
Molecular Properties
| Compound Name | CID 90244066 |
| PubChem CID | 90244066 |
| Molecular Formula | C5H8BFO3S |
| Molecular Weight | 177.99 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1S[C@](F)(CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C5H8BFO3S/c6-4-2(9)3(10)5(7,1-8)11-4/h2-4,8-10H,1H2/t2-,3+,4-,5-/m1/s1 |
| InChIKey | HGJBZRLRXOIIOD-KKQCNMDGSA-N |
| XLogP | -1.39 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.99 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90244066 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90244066?
The IUPAC name of CID 90244066 (CID 90244066) is not available.
What is the SMILES notation for CID 90244066?
The canonical SMILES for CID 90244066 is [B][C@@H]1S[C@](F)(CO)[C@@H](O)[C@H]1O.
What is the InChIKey of CID 90244066?
The InChIKey is HGJBZRLRXOIIOD-KKQCNMDGSA-N. The full InChI is InChI=1S/C5H8BFO3S/c6-4-2(9)3(10)5(7,1-8)11-4/h2-4,8-10H,1H2/t2-,3+,4-,5-/m1/s1.
What are the key properties of CID 90244066?
CID 90244066 has a molecular weight of 177.99 g/mol, XLogP of -1.39, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90244066 is sourced from PubChem (CID 90244066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).