About 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine
4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 90244098) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine |
| PubChem CID | 90244098 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | C=C1N=C(N)N=CN1C(C)C |
| InChI | InChI=1S/C7H12N4/c1-5(2)11-4-9-7(8)10-6(11)3/h4-5H,3H2,1-2H3,(H2,8,10) |
| InChIKey | RFHNFOBWNFRYIG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine?
The IUPAC name of 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine (CID 90244098) is 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine?
The canonical SMILES for 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine is C=C1N=C(N)N=CN1C(C)C.
What is the InChIKey of 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine?
The InChIKey is RFHNFOBWNFRYIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-5(2)11-4-9-7(8)10-6(11)3/h4-5H,3H2,1-2H3,(H2,8,10).
What are the key properties of 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine?
4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine has a molecular weight of 152.20 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-5-propan-2-yl-1,3,5-triazin-2-amine is sourced from PubChem (CID 90244098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).