About 5,6-di(propan-2-ylidene)-1,4-diazepane
5,6-di(propan-2-ylidene)-1,4-diazepane (PubChem CID 90244237) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 5,6-di(propan-2-ylidene)-1,4-diazepane.
Molecular Properties
| Compound Name | 5,6-di(propan-2-ylidene)-1,4-diazepane |
| PubChem CID | 90244237 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 5,6-di(propan-2-ylidene)-1,4-diazepane |
| SMILES | CC(C)=C1CNCCNC1=C(C)C |
| InChI | InChI=1S/C11H20N2/c1-8(2)10-7-12-5-6-13-11(10)9(3)4/h12-13H,5-7H2,1-4H3 |
| InChIKey | OAILRTFXFKEQPI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-di(propan-2-ylidene)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-di(propan-2-ylidene)-1,4-diazepane?
The IUPAC name of 5,6-di(propan-2-ylidene)-1,4-diazepane (CID 90244237) is 5,6-di(propan-2-ylidene)-1,4-diazepane.
What is the SMILES notation for 5,6-di(propan-2-ylidene)-1,4-diazepane?
The canonical SMILES for 5,6-di(propan-2-ylidene)-1,4-diazepane is CC(C)=C1CNCCNC1=C(C)C.
What is the InChIKey of 5,6-di(propan-2-ylidene)-1,4-diazepane?
The InChIKey is OAILRTFXFKEQPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-8(2)10-7-12-5-6-13-11(10)9(3)4/h12-13H,5-7H2,1-4H3.
What are the key properties of 5,6-di(propan-2-ylidene)-1,4-diazepane?
5,6-di(propan-2-ylidene)-1,4-diazepane has a molecular weight of 180.29 g/mol, XLogP of 1.81, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-di(propan-2-ylidene)-1,4-diazepane is sourced from PubChem (CID 90244237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).