About 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane
2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane (PubChem CID 90244254) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane.
Molecular Properties
| Compound Name | 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane |
| PubChem CID | 90244254 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane |
| SMILES | C=C1NCCC(=C(C)C)C(=C(C)C)N1 |
| InChI | InChI=1S/C12H20N2/c1-8(2)11-6-7-13-10(5)14-12(11)9(3)4/h13-14H,5-7H2,1-4H3 |
| InChIKey | NJWYUGALYKRDBS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane?
The IUPAC name of 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane (CID 90244254) is 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane.
What is the SMILES notation for 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane?
The canonical SMILES for 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane is C=C1NCCC(=C(C)C)C(=C(C)C)N1.
What is the InChIKey of 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane?
The InChIKey is NJWYUGALYKRDBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-8(2)11-6-7-13-10(5)14-12(11)9(3)4/h13-14H,5-7H2,1-4H3.
What are the key properties of 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane?
2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane has a molecular weight of 192.31 g/mol, XLogP of 2.67, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-4,5-di(propan-2-ylidene)-1,3-diazepane is sourced from PubChem (CID 90244254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).