C8H11NS — CID 90244269
4,6,7,8-tetrahydro-1H-thiepino[4,3-b]pyrrole (PubChem CID 90244269) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is 4,6,7,8-tetrahydro-1H-thiepino[4,3-b]pyrrole.
| Compound Name | 4,6,7,8-tetrahydro-1H-thiepino[4,3-b]pyrrole |
|---|---|
| PubChem CID | 90244269 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 4,6,7,8-tetrahydro-1H-thiepino[4,3-b]pyrrole |
| SMILES | c1cc2c([nH]1)CCCSC2 |
| InChI | InChI=1S/C8H11NS/c1-2-8-7(3-4-9-8)6-10-5-1/h3-4,9H,1-2,5-6H2 |
| InChIKey | JVZVPVVLAOPYKV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |