About [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol
[8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol (PubChem CID 90245055) has the molecular formula C12H19IS
and a molecular weight of 322.26 g/mol. Its IUPAC name is [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol.
Molecular Properties
| Compound Name | [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol |
| PubChem CID | 90245055 |
| Molecular Formula | C12H19IS |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol |
| SMILES | SCC1CC2C3CC(CI)C(C3)C2C1 |
| InChI | InChI=1S/C12H19IS/c13-5-9-3-8-4-11(9)12-2-7(6-14)1-10(8)12/h7-12,14H,1-6H2 |
| InChIKey | RSAFTAYSPPEJCL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol?
The IUPAC name of [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol (CID 90245055) is [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol.
What is the SMILES notation for [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol?
The canonical SMILES for [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol is SCC1CC2C3CC(CI)C(C3)C2C1.
What is the InChIKey of [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol?
The InChIKey is RSAFTAYSPPEJCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19IS/c13-5-9-3-8-4-11(9)12-2-7(6-14)1-10(8)12/h7-12,14H,1-6H2.
What are the key properties of [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol?
[8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol has a molecular weight of 322.26 g/mol, XLogP of 3.65, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(iodomethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanethiol is sourced from PubChem (CID 90245055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).