About methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate
methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate (PubChem CID 90245158) has the molecular formula C6H8O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate |
| PubChem CID | 90245158 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate |
| SMILES | [2H]/C(C(=O)CO)=C(/[2H])C(=O)OC |
| InChI | InChI=1S/C6H8O4/c1-10-6(9)3-2-5(8)4-7/h2-3,7H,4H2,1H3/b3-2+/i2D,3D |
| InChIKey | OLBMRRMLQLFXCQ-XNHULNRKSA-N |
| XLogP | -0.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate?
The IUPAC name of methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate (CID 90245158) is methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate.
What is the SMILES notation for methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate?
The canonical SMILES for methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate is [2H]/C(C(=O)CO)=C(/[2H])C(=O)OC.
What is the InChIKey of methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate?
The InChIKey is OLBMRRMLQLFXCQ-XNHULNRKSA-N. The full InChI is InChI=1S/C6H8O4/c1-10-6(9)3-2-5(8)4-7/h2-3,7H,4H2,1H3/b3-2+/i2D,3D.
What are the key properties of methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate?
methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate has a molecular weight of 146.14 g/mol, XLogP of -0.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2,3-dideuterio-5-hydroxy-4-oxopent-2-enoate is sourced from PubChem (CID 90245158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).