C11H21N — CID 90245566
(3E,5Z)-N-ethyl-N,3-dimethylhepta-3,5-dien-1-amine (PubChem CID 90245566) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (3E,5Z)-N-ethyl-N,3-dimethylhepta-3,5-dien-1-amine.
| Compound Name | (3E,5Z)-N-ethyl-N,3-dimethylhepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 90245566 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (3E,5Z)-N-ethyl-N,3-dimethylhepta-3,5-dien-1-amine |
| SMILES | C/C=C\C=C(/C)CCN(C)CC |
| InChI | InChI=1S/C11H21N/c1-5-7-8-11(3)9-10-12(4)6-2/h5,7-8H,6,9-10H2,1-4H3/b7-5-,11-8+ |
| InChIKey | SRZOYSUYLNZUPI-UKJSTWFMSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|