About (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide
(3Z)-3-hydrazinylidene-N,2-dimethylpropanamide (PubChem CID 90245610) has the molecular formula C5H11N3O
and a molecular weight of 129.16 g/mol. Its IUPAC name is (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide |
| PubChem CID | 90245610 |
| Molecular Formula | C5H11N3O |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.09 |
| IUPAC Name | (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)/C=N\N |
| InChI | InChI=1S/C5H11N3O/c1-4(3-8-6)5(9)7-2/h3-4H,6H2,1-2H3,(H,7,9)/b8-3- |
| InChIKey | RAXQMCXLJFWPQO-BAQGIRSFSA-N |
| XLogP | -0.69 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide?
The IUPAC name of (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide (CID 90245610) is (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide.
What is the SMILES notation for (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide?
The canonical SMILES for (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide is CNC(=O)C(C)/C=N\N.
What is the InChIKey of (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide?
The InChIKey is RAXQMCXLJFWPQO-BAQGIRSFSA-N. The full InChI is InChI=1S/C5H11N3O/c1-4(3-8-6)5(9)7-2/h3-4H,6H2,1-2H3,(H,7,9)/b8-3-.
What are the key properties of (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide?
(3Z)-3-hydrazinylidene-N,2-dimethylpropanamide has a molecular weight of 129.16 g/mol, XLogP of -0.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-hydrazinylidene-N,2-dimethylpropanamide is sourced from PubChem (CID 90245610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).