About (3Z)-N-methylhexa-3,5-dienamide
(3Z)-N-methylhexa-3,5-dienamide (PubChem CID 90245827) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is (3Z)-N-methylhexa-3,5-dienamide.
Molecular Properties
| Compound Name | (3Z)-N-methylhexa-3,5-dienamide |
| PubChem CID | 90245827 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (3Z)-N-methylhexa-3,5-dienamide |
| SMILES | C=C/C=C\CC(=O)NC |
| InChI | InChI=1S/C7H11NO/c1-3-4-5-6-7(9)8-2/h3-5H,1,6H2,2H3,(H,8,9)/b5-4- |
| InChIKey | YOVPOCLZLPJOPC-PLNGDYQASA-N |
| XLogP | 0.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N-methylhexa-3,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N-methylhexa-3,5-dienamide?
The IUPAC name of (3Z)-N-methylhexa-3,5-dienamide (CID 90245827) is (3Z)-N-methylhexa-3,5-dienamide.
What is the SMILES notation for (3Z)-N-methylhexa-3,5-dienamide?
The canonical SMILES for (3Z)-N-methylhexa-3,5-dienamide is C=C/C=C\CC(=O)NC.
What is the InChIKey of (3Z)-N-methylhexa-3,5-dienamide?
The InChIKey is YOVPOCLZLPJOPC-PLNGDYQASA-N. The full InChI is InChI=1S/C7H11NO/c1-3-4-5-6-7(9)8-2/h3-5H,1,6H2,2H3,(H,8,9)/b5-4-.
What are the key properties of (3Z)-N-methylhexa-3,5-dienamide?
(3Z)-N-methylhexa-3,5-dienamide has a molecular weight of 125.17 g/mol, XLogP of 0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N-methylhexa-3,5-dienamide is sourced from PubChem (CID 90245827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).