About (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide
(Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide (PubChem CID 90245910) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide.
Molecular Properties
| Compound Name | (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide |
| PubChem CID | 90245910 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide |
| SMILES | C=N/C=C\C(C)C(=O)NC |
| InChI | InChI=1S/C7H12N2O/c1-6(4-5-8-2)7(10)9-3/h4-6H,2H2,1,3H3,(H,9,10)/b5-4- |
| InChIKey | SFJVMOQIHLBCPU-PLNGDYQASA-N |
| XLogP | 0.58 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide?
The IUPAC name of (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide (CID 90245910) is (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide.
What is the SMILES notation for (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide?
The canonical SMILES for (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide is C=N/C=C\C(C)C(=O)NC.
What is the InChIKey of (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide?
The InChIKey is SFJVMOQIHLBCPU-PLNGDYQASA-N. The full InChI is InChI=1S/C7H12N2O/c1-6(4-5-8-2)7(10)9-3/h4-6H,2H2,1,3H3,(H,9,10)/b5-4-.
What are the key properties of (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide?
(Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide has a molecular weight of 140.19 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,2-dimethyl-4-(methylideneamino)but-3-enamide is sourced from PubChem (CID 90245910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).