C28H32FN9O2 — CID 90246077
tert-butyl 4-[5-[2-(aminodiazenyl)imidazo[1,2-b]pyridazin-6-yl]-2-cyclopropyl-4-(4-fluorophenyl)imidazol-1-yl]piperidine-1-carboxylate (PubChem CID 90246077) has the molecular formula C28H32FN9O2 and a molecular weight of 545.62 g/mol. Its IUPAC name is tert-butyl 4-[5-[2-(aminodiazenyl)imidazo[1,2-b]pyridazin-6-yl]-2-cyclopropyl-4-(4-fluorophenyl)imidazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[2-(aminodiazenyl)imidazo[1,2-b]pyridazin-6-yl]-2-cyclopropyl-4-(4-fluorophenyl)imidazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90246077 |
| Molecular Formula | C28H32FN9O2 |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | tert-butyl 4-[5-[2-(aminodiazenyl)imidazo[1,2-b]pyridazin-6-yl]-2-cyclopropyl-4-(4-fluorophenyl)imidazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2c(C3CC3)nc(-c3ccc(F)cc3)c2-c2ccc3nc(N=NN)cn3n2)CC1 |
| InChI | InChI=1S/C28H32FN9O2/c1-28(2,3)40-27(39)36-14-12-20(13-15-36)38-25(21-10-11-23-31-22(33-35-30)16-37(23)34-21)24(32-26(38)18-4-5-18)17-6-8-19(29)9-7-17/h6-11,16,18,20H,4-5,12-15H2,1-3H3,(H2,30,33) |
| InChIKey | XKWPPVFAPYTQFV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|