About (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one
(6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one (PubChem CID 90246590) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one.
Molecular Properties
| Compound Name | (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one |
| PubChem CID | 90246590 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one |
| SMILES | C=C[C@H](C)CC(=O)CC(C)(C)O |
| InChI | InChI=1S/C10H18O2/c1-5-8(2)6-9(11)7-10(3,4)12/h5,8,12H,1,6-7H2,2-4H3/t8-/m0/s1 |
| InChIKey | WNALYPLUEBXVSC-QMMMGPOBSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one?
The IUPAC name of (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one (CID 90246590) is (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one.
What is the SMILES notation for (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one?
The canonical SMILES for (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one is C=C[C@H](C)CC(=O)CC(C)(C)O.
What is the InChIKey of (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one?
The InChIKey is WNALYPLUEBXVSC-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H18O2/c1-5-8(2)6-9(11)7-10(3,4)12/h5,8,12H,1,6-7H2,2-4H3/t8-/m0/s1.
What are the key properties of (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one?
(6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one has a molecular weight of 170.25 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2-hydroxy-2,6-dimethyloct-7-en-4-one is sourced from PubChem (CID 90246590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).