C28H38FN6O8P — CID 90246755
cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90246755) has the molecular formula C28H38FN6O8P and a molecular weight of 636.62 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90246755 |
| Molecular Formula | C28H38FN6O8P |
| Molecular Weight | 636.62 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OC2CCCCC2)Oc2ccccc2)[C@@H](F)[C@@]1(C)O |
| InChI | InChI=1S/C28H38FN6O8P/c1-4-39-24-21-23(32-27(30)33-24)35(16-31-21)26-28(3,37)22(29)20(42-26)15-40-44(38,43-19-13-9-6-10-14-19)34-17(2)25(36)41-18-11-7-5-8-12-18/h6,9-10,13-14,16-18,20,22,26,37H,4-5,7-8,11-12,15H2,1-3H3,(H,34,38)(H2,30,32,33)/t17-,20+,22+,26+,28+,44?/m0/s1 |
| InChIKey | ULXLNXXEFXYVAP-LCHUHNCVSA-N |
| XLogP | 3.85 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|