About tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate
tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate (PubChem CID 90246865) has the molecular formula C19H32N2O4
and a molecular weight of 352.48 g/mol. Its IUPAC name is tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate |
| PubChem CID | 90246865 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate |
| SMILES | CCCCOc1nc(C)cc(C)c1CN(CCO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N2O4/c1-7-8-11-24-17-16(14(2)12-15(3)20-17)13-21(9-10-22)18(23)25-19(4,5)6/h12,22H,7-11,13H2,1-6H3 |
| InChIKey | SDKYAGJDIOWFJJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate?
The IUPAC name of tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate (CID 90246865) is tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate.
What is the SMILES notation for tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate?
The canonical SMILES for tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate is CCCCOc1nc(C)cc(C)c1CN(CCO)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate?
The InChIKey is SDKYAGJDIOWFJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O4/c1-7-8-11-24-17-16(14(2)12-15(3)20-17)13-21(9-10-22)18(23)25-19(4,5)6/h12,22H,7-11,13H2,1-6H3.
What are the key properties of tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate?
tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate has a molecular weight of 352.48 g/mol, XLogP of 3.61, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate is sourced from PubChem (CID 90246865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).