C22H25ClF2N2O3 — CID 90246868
2-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-8-chloro-7-(difluoromethoxy)-3,4-dihydroisoquinolin-1-one (PubChem CID 90246868) has the molecular formula C22H25ClF2N2O3 and a molecular weight of 438.90 g/mol. Its IUPAC name is 2-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-8-chloro-7-(difluoromethoxy)-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-8-chloro-7-(difluoromethoxy)-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 90246868 |
| Molecular Formula | C22H25ClF2N2O3 |
| Molecular Weight | 438.90 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-8-chloro-7-(difluoromethoxy)-3,4-dihydroisoquinolin-1-one |
| SMILES | CCCCOc1nc(C)cc(C)c1CN1CCc2ccc(OC(F)F)c(Cl)c2C1=O |
| InChI | InChI=1S/C22H25ClF2N2O3/c1-4-5-10-29-20-16(13(2)11-14(3)26-20)12-27-9-8-15-6-7-17(30-22(24)25)19(23)18(15)21(27)28/h6-7,11,22H,4-5,8-10,12H2,1-3H3 |
| InChIKey | ONVNHBBPUUBYPM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.90 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|