C20H40N2 — CID 90246911
N-deuterio-N-methyl-1-(2,3,3,4,4,5,5,6,6-nonamethyl-1-propan-2-ylpiperidin-2-yl)ethenamine (PubChem CID 90246911) has the molecular formula C20H40N2 and a molecular weight of 309.56 g/mol. Its IUPAC name is N-deuterio-N-methyl-1-(2,3,3,4,4,5,5,6,6-nonamethyl-1-propan-2-ylpiperidin-2-yl)ethenamine.
| Compound Name | N-deuterio-N-methyl-1-(2,3,3,4,4,5,5,6,6-nonamethyl-1-propan-2-ylpiperidin-2-yl)ethenamine |
|---|---|
| PubChem CID | 90246911 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 309.56 g/mol |
| Exact Mass | 309.33 |
| IUPAC Name | N-deuterio-N-methyl-1-(2,3,3,4,4,5,5,6,6-nonamethyl-1-propan-2-ylpiperidin-2-yl)ethenamine |
| SMILES | [2H]N(C)C(=C)C1(C)N(C(C)C)C(C)(C)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C20H40N2/c1-14(2)22-19(10,11)17(6,7)16(4,5)18(8,9)20(22,12)15(3)21-13/h14,21H,3H2,1-2,4-13H3/i/hD |
| InChIKey | WCUVAVFOPGSPNH-DYCDLGHISA-N |
| XLogP | 5.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |