About 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane]
1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane] (PubChem CID 90247763) has the molecular formula C15H21N3O2
and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane].
Molecular Properties
| Compound Name | 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane] |
| PubChem CID | 90247763 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane] |
| SMILES | c1cnc2c(c1)N(N1CCOCC1)CC21CCOCC1 |
| InChI | InChI=1S/C15H21N3O2/c1-2-13-14(16-5-1)15(3-8-19-9-4-15)12-18(13)17-6-10-20-11-7-17/h1-2,5H,3-4,6-12H2 |
| InChIKey | KWVKRDPNOCWOKQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane]?
The IUPAC name of 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane] (CID 90247763) is 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane].
What is the SMILES notation for 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane]?
The canonical SMILES for 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane] is c1cnc2c(c1)N(N1CCOCC1)CC21CCOCC1.
What is the InChIKey of 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane]?
The InChIKey is KWVKRDPNOCWOKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2/c1-2-13-14(16-5-1)15(3-8-19-9-4-15)12-18(13)17-6-10-20-11-7-17/h1-2,5H,3-4,6-12H2.
What are the key properties of 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane]?
1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane] has a molecular weight of 275.35 g/mol, XLogP of 1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylspiro[2H-pyrrolo[3,2-b]pyridine-3,4'-oxane] is sourced from PubChem (CID 90247763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).