C17H19ClFN2O+ — CID 9024780
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]-methyl-[(4-methylphenyl)methyl]azanium (PubChem CID 9024780) has the molecular formula C17H19ClFN2O+ and a molecular weight of 321.80 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl]-methyl-[(4-methylphenyl)methyl]azanium.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl]-methyl-[(4-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9024780 |
| Molecular Formula | C17H19ClFN2O+ |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl]-methyl-[(4-methylphenyl)methyl]azanium |
| SMILES | Cc1ccc(C[NH+](C)CC(=O)Nc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C17H18ClFN2O/c1-12-3-5-13(6-4-12)10-21(2)11-17(22)20-16-8-7-14(19)9-15(16)18/h3-9H,10-11H2,1-2H3,(H,20,22)/p+1 |
| InChIKey | ZVSYJPROYFNVNZ-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |