C19H20ClFN4O3 — CID 90247861
tert-butyl N-[3-[buta-1,3-dien-2-yl(hydroxy)amino]phenyl]-N-(2-chloro-5-fluoropyrimidin-4-yl)carbamate (PubChem CID 90247861) has the molecular formula C19H20ClFN4O3 and a molecular weight of 406.85 g/mol. Its IUPAC name is tert-butyl N-[3-[buta-1,3-dien-2-yl(hydroxy)amino]phenyl]-N-(2-chloro-5-fluoropyrimidin-4-yl)carbamate.
| Compound Name | tert-butyl N-[3-[buta-1,3-dien-2-yl(hydroxy)amino]phenyl]-N-(2-chloro-5-fluoropyrimidin-4-yl)carbamate |
|---|---|
| PubChem CID | 90247861 |
| Molecular Formula | C19H20ClFN4O3 |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | tert-butyl N-[3-[buta-1,3-dien-2-yl(hydroxy)amino]phenyl]-N-(2-chloro-5-fluoropyrimidin-4-yl)carbamate |
| SMILES | C=CC(=C)N(O)c1cccc(N(C(=O)OC(C)(C)C)c2nc(Cl)ncc2F)c1 |
| InChI | InChI=1S/C19H20ClFN4O3/c1-6-12(2)25(27)14-9-7-8-13(10-14)24(18(26)28-19(3,4)5)16-15(21)11-22-17(20)23-16/h6-11,27H,1-2H2,3-5H3 |
| InChIKey | VLNHJJMJEWOQKQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|