C47H41FIN5O7 — CID 90247881
[(2R,3S,4R,5R)-4-benzoyloxy-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-fluoro-2-(iodomethyl)-4-methyloxolan-3-yl] benzoate (PubChem CID 90247881) has the molecular formula C47H41FIN5O7 and a molecular weight of 933.78 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-benzoyloxy-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-fluoro-2-(iodomethyl)-4-methyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R)-4-benzoyloxy-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-fluoro-2-(iodomethyl)-4-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 90247881 |
| Molecular Formula | C47H41FIN5O7 |
| Molecular Weight | 933.78 g/mol |
| Exact Mass | 933.20 |
| IUPAC Name | [(2R,3S,4R,5R)-4-benzoyloxy-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-fluoro-2-(iodomethyl)-4-methyloxolan-3-yl] benzoate |
| SMILES | CCOc1nc(NC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)nc2c1ncn2[C@@H]1O[C@](F)(CI)[C@@H](OC(=O)c2ccccc2)[C@@]1(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C47H41FIN5O7/c1-4-58-39-37-38(51-44(52-39)53-47(33-21-13-7-14-22-33,34-23-15-8-16-24-34)35-25-27-36(57-3)28-26-35)54(30-50-37)43-45(2,60-41(56)32-19-11-6-12-20-32)42(46(48,29-49)61-43)59-40(55)31-17-9-5-10-18-31/h5-28,30,42-43H,4,29H2,1-3H3,(H,51,52,53)/t42-,43+,45+,46+/m0/s1 |
| InChIKey | ZJQGGJWYNVEWTP-HUTISQBZSA-N |
| XLogP | 9.11 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.78 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|