C54H46FN5O9 — CID 90247885
[(2S,3S,4R,5R)-3,4-dibenzoyloxy-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-fluoro-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 90247885) has the molecular formula C54H46FN5O9 and a molecular weight of 927.99 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-3,4-dibenzoyloxy-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-fluoro-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3S,4R,5R)-3,4-dibenzoyloxy-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-fluoro-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 90247885 |
| Molecular Formula | C54H46FN5O9 |
| Molecular Weight | 927.99 g/mol |
| Exact Mass | 927.33 |
| IUPAC Name | [(2S,3S,4R,5R)-3,4-dibenzoyloxy-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-fluoro-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | CCOc1nc(NC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)nc2c1ncn2[C@@H]1O[C@](F)(COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@]1(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C54H46FN5O9/c1-4-65-45-43-44(57-51(58-45)59-54(39-26-16-8-17-27-39,40-28-18-9-19-29-40)41-30-32-42(64-3)33-31-41)60(35-56-43)50-52(2,68-48(63)38-24-14-7-15-25-38)49(67-47(62)37-22-12-6-13-23-37)53(55,69-50)34-66-46(61)36-20-10-5-11-21-36/h5-33,35,49-50H,4,34H2,1-3H3,(H,57,58,59)/t49-,50+,52+,53+/m0/s1 |
| InChIKey | SXYSBEIIFUXTNZ-QXEVZKETSA-N |
| XLogP | 9.53 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.99 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|