C40H36F2IN5O5 — CID 90248043
[(2R,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2,4-difluoro-2-(iodomethyl)-4-methyloxolan-3-yl] benzoate (PubChem CID 90248043) has the molecular formula C40H36F2IN5O5 and a molecular weight of 831.66 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2,4-difluoro-2-(iodomethyl)-4-methyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2,4-difluoro-2-(iodomethyl)-4-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 90248043 |
| Molecular Formula | C40H36F2IN5O5 |
| Molecular Weight | 831.66 g/mol |
| Exact Mass | 831.17 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2,4-difluoro-2-(iodomethyl)-4-methyloxolan-3-yl] benzoate |
| SMILES | CCOc1nc(NC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)nc2c1ncn2[C@@H]1O[C@](F)(CI)[C@@H](OC(=O)c2ccccc2)[C@@]1(C)F |
| InChI | InChI=1S/C40H36F2IN5O5/c1-4-51-33-31-32(48(25-44-31)36-38(2,41)35(39(42,24-43)53-36)52-34(49)26-14-8-5-9-15-26)45-37(46-33)47-40(27-16-10-6-11-17-27,28-18-12-7-13-19-28)29-20-22-30(50-3)23-21-29/h5-23,25,35-36H,4,24H2,1-3H3,(H,45,46,47)/t35-,36+,38+,39+/m0/s1 |
| InChIKey | IRNCONNVSUKTHI-LTPHXHEOSA-N |
| XLogP | 8.22 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.66 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|