About N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide
N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide (PubChem CID 90248273) has the molecular formula C13H26N4O
and a molecular weight of 254.38 g/mol. Its IUPAC name is N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide |
| PubChem CID | 90248273 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide |
| SMILES | C/C=C\CCN(CC)CC(O)C/N=C/N/C=N/C |
| InChI | InChI=1S/C13H26N4O/c1-4-6-7-8-17(5-2)10-13(18)9-15-12-16-11-14-3/h4,6,11-13,18H,5,7-10H2,1-3H3,(H,14,15,16)/b6-4- |
| InChIKey | YDJCCNGTLUVUJV-XQRVVYSFSA-N |
| XLogP | 0.91 |
| TPSA | 60.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide?
The IUPAC name of N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide (CID 90248273) is N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide.
What is the SMILES notation for N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide?
The canonical SMILES for N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide is C/C=C\CCN(CC)CC(O)C/N=C/N/C=N/C.
What is the InChIKey of N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide?
The InChIKey is YDJCCNGTLUVUJV-XQRVVYSFSA-N. The full InChI is InChI=1S/C13H26N4O/c1-4-6-7-8-17(5-2)10-13(18)9-15-12-16-11-14-3/h4,6,11-13,18H,5,7-10H2,1-3H3,(H,14,15,16)/b6-4-.
What are the key properties of N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide?
N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide has a molecular weight of 254.38 g/mol, XLogP of 0.91, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-[ethyl-[(Z)-pent-3-enyl]amino]-2-hydroxypropyl]iminomethyl]-N'-methylmethanimidamide is sourced from PubChem (CID 90248273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).