C14H18N4O4S — CID 90248503
(5R)-2'-methyl-3-nitro-1',1'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-6H-1,2,4-thiadiazine]-3'-amine (PubChem CID 90248503) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is (5R)-2'-methyl-3-nitro-1',1'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-6H-1,2,4-thiadiazine]-3'-amine.
| Compound Name | (5R)-2'-methyl-3-nitro-1',1'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-6H-1,2,4-thiadiazine]-3'-amine |
|---|---|
| PubChem CID | 90248503 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (5R)-2'-methyl-3-nitro-1',1'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-6H-1,2,4-thiadiazine]-3'-amine |
| SMILES | CN1C(N)=N[C@@]2(CCCCc3ccc([N+](=O)[O-])cc32)CS1(=O)=O |
| InChI | InChI=1S/C14H18N4O4S/c1-17-13(15)16-14(9-23(17,21)22)7-3-2-4-10-5-6-11(18(19)20)8-12(10)14/h5-6,8H,2-4,7,9H2,1H3,(H2,15,16)/t14-/m0/s1 |
| InChIKey | XPLFAMDLDRKZKI-AWEZNQCLSA-N |
| XLogP | 1.11 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|