C21H24F3N3O4 — CID 90248559
(3aR,5S,7aS,7bR)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1-(2,2,2-trifluoroethyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione (PubChem CID 90248559) has the molecular formula C21H24F3N3O4 and a molecular weight of 439.43 g/mol. Its IUPAC name is (3aR,5S,7aS,7bR)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1-(2,2,2-trifluoroethyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3aR,5S,7aS,7bR)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1-(2,2,2-trifluoroethyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 90248559 |
| Molecular Formula | C21H24F3N3O4 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (3aR,5S,7aS,7bR)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1-(2,2,2-trifluoroethyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccc(O)cc1[C@]12CC3CN(CC(F)(F)F)[C@H]3[C@]1(O)CC[C@@]1(C2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H24F3N3O4/c1-11-2-3-13(28)6-14(11)18-7-12-8-27(10-21(22,23)24)15(12)20(18,31)5-4-19(9-18)16(29)25-17(30)26-19/h2-3,6,12,15,28,31H,4-5,7-10H2,1H3,(H2,25,26,29,30)/t12?,15-,18-,19+,20-/m1/s1 |
| InChIKey | VFDIOOBOMOEUBX-OSKOASLUSA-N |
| XLogP | 1.70 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|