C25H36N4O3 — CID 90248598
[17-(2-methoxyethyl)-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-7-yl] N-[2-(dimethylamino)ethyl]carbamate (PubChem CID 90248598) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is [17-(2-methoxyethyl)-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-7-yl] N-[2-(dimethylamino)ethyl]carbamate.
| Compound Name | [17-(2-methoxyethyl)-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-7-yl] N-[2-(dimethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 90248598 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | [17-(2-methoxyethyl)-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-7-yl] N-[2-(dimethylamino)ethyl]carbamate |
| SMILES | COCCC1CC2CC3c4[nH]c5ccc(OC(=O)NCCN(C)C)cc5c4CCN(C2)C13 |
| InChI | InChI=1S/C25H36N4O3/c1-28(2)10-8-26-25(30)32-18-4-5-22-20(14-18)19-6-9-29-15-16-12-17(7-11-31-3)24(29)21(13-16)23(19)27-22/h4-5,14,16-17,21,24,27H,6-13,15H2,1-3H3,(H,26,30) |
| InChIKey | GJTNJWLHXPNULA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |