About methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate
methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate (PubChem CID 90248677) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate.
Molecular Properties
| Compound Name | methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate |
| PubChem CID | 90248677 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate |
| SMILES | C=C/C=C\C/N=C(\C)SC |
| InChI | InChI=1S/C8H13NS/c1-4-5-6-7-9-8(2)10-3/h4-6H,1,7H2,2-3H3/b6-5-,9-8+ |
| InChIKey | KZFBWICRCNBQDV-UEPDSTOUSA-N |
| XLogP | 2.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate?
The IUPAC name of methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate (CID 90248677) is methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate.
What is the SMILES notation for methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate?
The canonical SMILES for methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate is C=C/C=C\C/N=C(\C)SC.
What is the InChIKey of methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate?
The InChIKey is KZFBWICRCNBQDV-UEPDSTOUSA-N. The full InChI is InChI=1S/C8H13NS/c1-4-5-6-7-9-8(2)10-3/h4-6H,1,7H2,2-3H3/b6-5-,9-8+.
What are the key properties of methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate?
methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate has a molecular weight of 155.27 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(2Z)-penta-2,4-dienyl]ethanimidothioate is sourced from PubChem (CID 90248677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).