About [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine
[(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine (PubChem CID 90248970) has the molecular formula C7H13F3N4
and a molecular weight of 210.20 g/mol. Its IUPAC name is [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine.
Molecular Properties
| Compound Name | [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine |
| PubChem CID | 90248970 |
| Molecular Formula | C7H13F3N4 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine |
| SMILES | C=C1CNCCN1[C@@H](NN)C(F)(F)F |
| InChI | InChI=1S/C7H13F3N4/c1-5-4-12-2-3-14(5)6(13-11)7(8,9)10/h6,12-13H,1-4,11H2/t6-/m1/s1 |
| InChIKey | MJLHBYMTBUTADT-ZCFIWIBFSA-N |
| XLogP | -0.24 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine?
The IUPAC name of [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine (CID 90248970) is [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine.
What is the SMILES notation for [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine?
The canonical SMILES for [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine is C=C1CNCCN1[C@@H](NN)C(F)(F)F.
What is the InChIKey of [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine?
The InChIKey is MJLHBYMTBUTADT-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H13F3N4/c1-5-4-12-2-3-14(5)6(13-11)7(8,9)10/h6,12-13H,1-4,11H2/t6-/m1/s1.
What are the key properties of [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine?
[(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine has a molecular weight of 210.20 g/mol, XLogP of -0.24, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2,2,2-trifluoro-1-(2-methylidenepiperazin-1-yl)ethyl]hydrazine is sourced from PubChem (CID 90248970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).