C52H32N6 — CID 90249133
22-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9-pyridin-2-yl-9,22-diazahexacyclo[17.2.1.02,10.03,8.012,21.015,20]docosa-1(21),2(10),3,5,7,11,13,15(20),16,18-decaene (PubChem CID 90249133) has the molecular formula C52H32N6 and a molecular weight of 740.87 g/mol. Its IUPAC name is 22-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9-pyridin-2-yl-9,22-diazahexacyclo[17.2.1.02,10.03,8.012,21.015,20]docosa-1(21),2(10),3,5,7,11,13,15(20),16,18-decaene.
| Compound Name | 22-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9-pyridin-2-yl-9,22-diazahexacyclo[17.2.1.02,10.03,8.012,21.015,20]docosa-1(21),2(10),3,5,7,11,13,15(20),16,18-decaene |
|---|---|
| PubChem CID | 90249133 |
| Molecular Formula | C52H32N6 |
| Molecular Weight | 740.87 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | 22-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9-pyridin-2-yl-9,22-diazahexacyclo[17.2.1.02,10.03,8.012,21.015,20]docosa-1(21),2(10),3,5,7,11,13,15(20),16,18-decaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc(-n5c6cccc7ccc8cc9c(c%10ccccc%10n9-c9ccccn9)c5c8c76)c4)c3)n2)cc1 |
| InChI | InChI=1S/C52H32N6/c1-3-14-34(15-4-1)50-54-51(35-16-5-2-6-17-35)56-52(55-50)39-21-11-19-36(30-39)37-20-12-22-40(31-37)57-43-25-13-18-33-27-28-38-32-44-48(49(57)47(38)46(33)43)41-23-7-8-24-42(41)58(44)45-26-9-10-29-53-45/h1-32H |
| InChIKey | PHTQCBHOMADRDU-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.87 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|