About 4-phenyl-1,2,3-benzotriazine
4-phenyl-1,2,3-benzotriazine (PubChem CID 902494) has the molecular formula C13H9N3
and a molecular weight of 207.24 g/mol. Its IUPAC name is 4-phenyl-1,2,3-benzotriazine.
Molecular Properties
| Compound Name | 4-phenyl-1,2,3-benzotriazine |
| PubChem CID | 902494 |
| Molecular Formula | C13H9N3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 4-phenyl-1,2,3-benzotriazine |
| SMILES | c1ccc(-c2nnnc3ccccc23)cc1 |
| InChI | InChI=1S/C13H9N3/c1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)14-16-15-13/h1-9H |
| InChIKey | YSKOFAYGTBLQTL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenyl-1,2,3-benzotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1,2,3-benzotriazine?
The IUPAC name of 4-phenyl-1,2,3-benzotriazine (CID 902494) is 4-phenyl-1,2,3-benzotriazine.
What is the SMILES notation for 4-phenyl-1,2,3-benzotriazine?
The canonical SMILES for 4-phenyl-1,2,3-benzotriazine is c1ccc(-c2nnnc3ccccc23)cc1.
What is the InChIKey of 4-phenyl-1,2,3-benzotriazine?
The InChIKey is YSKOFAYGTBLQTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3/c1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)14-16-15-13/h1-9H.
What are the key properties of 4-phenyl-1,2,3-benzotriazine?
4-phenyl-1,2,3-benzotriazine has a molecular weight of 207.24 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1,2,3-benzotriazine is sourced from PubChem (CID 902494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).