C35H16F2N2S — CID 90250088
22-[7-(3,5-Difluorophenyl)quinolin-3-yl]-8-thia-22-azaheptacyclo[13.6.1.04,20.07,19.09,18.012,17.016,21]docosa-1(21),2,4(20),5,7(19),9(18),10,12(17),13,15-decaene (PubChem CID 90250088) has the molecular formula C35H16F2N2S and a molecular weight of 534.60 g/mol. Its IUPAC name is 22-[7-(3,5-difluorophenyl)quinolin-3-yl]-8-thia-22-azaheptacyclo[13.6.1.04,20.07,19.09,18.012,17.016,21]docosa-1(21),2,4(20),5,7(19),9(18),10,12(17),13,15-decaene.
| Compound Name | 22-[7-(3,5-Difluorophenyl)quinolin-3-yl]-8-thia-22-azaheptacyclo[13.6.1.04,20.07,19.09,18.012,17.016,21]docosa-1(21),2,4(20),5,7(19),9(18),10,12(17),13,15-decaene |
|---|---|
| PubChem CID | 90250088 |
| Molecular Formula | C35H16F2N2S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 22-[7-(3,5-difluorophenyl)quinolin-3-yl]-8-thia-22-azaheptacyclo[13.6.1.04,20.07,19.09,18.012,17.016,21]docosa-1(21),2,4(20),5,7(19),9(18),10,12(17),13,15-decaene |
| SMILES | C1=CC2=C3C4=C1C=CC5=C4C6=C(S5)C=CC7=C6C3=C(N2C8=CN=C9C=C(C=CC9=C8)C1=CC(=CC(=C1)F)F)C=C7 |
| InChI | InChI=1S/C35H16F2N2S/c36-22-11-21(12-23(37)15-22)19-1-2-20-13-24(16-38-25(20)14-19)39-26-7-3-17-5-9-28-34-30(17)32(26)33-27(39)8-4-18-6-10-29(40-28)35(34)31(18)33/h1-16H |
| InChIKey | XFQQAPJSNOXBSN-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 46.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | 954 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|