About (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one
(4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one (PubChem CID 90250344) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one.
Molecular Properties
| Compound Name | (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one |
| PubChem CID | 90250344 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one |
| SMILES | C[C@@H]1C=C[C@H](O[C@@H]2COCC2=O)C1 |
| InChI | InChI=1S/C10H14O3/c1-7-2-3-8(4-7)13-10-6-12-5-9(10)11/h2-3,7-8,10H,4-6H2,1H3/t7-,8+,10-/m1/s1 |
| InChIKey | ZQFJQDLRESLTEQ-KHQFGBGNSA-N |
| XLogP | 0.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one?
The IUPAC name of (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one (CID 90250344) is (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one.
What is the SMILES notation for (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one?
The canonical SMILES for (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one is C[C@@H]1C=C[C@H](O[C@@H]2COCC2=O)C1.
What is the InChIKey of (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one?
The InChIKey is ZQFJQDLRESLTEQ-KHQFGBGNSA-N. The full InChI is InChI=1S/C10H14O3/c1-7-2-3-8(4-7)13-10-6-12-5-9(10)11/h2-3,7-8,10H,4-6H2,1H3/t7-,8+,10-/m1/s1.
What are the key properties of (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one?
(4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one has a molecular weight of 182.22 g/mol, XLogP of 0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[(1R,4S)-4-methylcyclopent-2-en-1-yl]oxyoxolan-3-one is sourced from PubChem (CID 90250344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).