About 2-ethenylimino-N'-ethylethanimidamide
2-ethenylimino-N'-ethylethanimidamide (PubChem CID 90250548) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-ethenylimino-N'-ethylethanimidamide.
Molecular Properties
| Compound Name | 2-ethenylimino-N'-ethylethanimidamide |
| PubChem CID | 90250548 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 2-ethenylimino-N'-ethylethanimidamide |
| SMILES | C=C/N=C/C(N)=N/CC |
| InChI | InChI=1S/C6H11N3/c1-3-8-5-6(7)9-4-2/h3,5H,1,4H2,2H3,(H2,7,9)/b8-5+ |
| InChIKey | RQEFTLKBUWLUJK-VMPITWQZSA-N |
| XLogP | 0.58 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylimino-N'-ethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylimino-N'-ethylethanimidamide?
The IUPAC name of 2-ethenylimino-N'-ethylethanimidamide (CID 90250548) is 2-ethenylimino-N'-ethylethanimidamide.
What is the SMILES notation for 2-ethenylimino-N'-ethylethanimidamide?
The canonical SMILES for 2-ethenylimino-N'-ethylethanimidamide is C=C/N=C/C(N)=N/CC.
What is the InChIKey of 2-ethenylimino-N'-ethylethanimidamide?
The InChIKey is RQEFTLKBUWLUJK-VMPITWQZSA-N. The full InChI is InChI=1S/C6H11N3/c1-3-8-5-6(7)9-4-2/h3,5H,1,4H2,2H3,(H2,7,9)/b8-5+.
What are the key properties of 2-ethenylimino-N'-ethylethanimidamide?
2-ethenylimino-N'-ethylethanimidamide has a molecular weight of 125.17 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylimino-N'-ethylethanimidamide is sourced from PubChem (CID 90250548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).