About N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide
N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide (PubChem CID 90250575) has the molecular formula C14H27N3O
and a molecular weight of 253.39 g/mol. Its IUPAC name is N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide |
| PubChem CID | 90250575 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide |
| SMILES | C=C/C=C\CCN(CCC)CC(O)CN/C=N/C |
| InChI | InChI=1S/C14H27N3O/c1-4-6-7-8-10-17(9-5-2)12-14(18)11-16-13-15-3/h4,6-7,13-14,18H,1,5,8-12H2,2-3H3,(H,15,16)/b7-6- |
| InChIKey | DRHNTEOHDMWHSJ-SREVYHEPSA-N |
| XLogP | 1.44 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide?
The IUPAC name of N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide (CID 90250575) is N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide.
What is the SMILES notation for N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide?
The canonical SMILES for N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide is C=C/C=C\CCN(CCC)CC(O)CN/C=N/C.
What is the InChIKey of N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide?
The InChIKey is DRHNTEOHDMWHSJ-SREVYHEPSA-N. The full InChI is InChI=1S/C14H27N3O/c1-4-6-7-8-10-17(9-5-2)12-14(18)11-16-13-15-3/h4,6-7,13-14,18H,1,5,8-12H2,2-3H3,(H,15,16)/b7-6-.
What are the key properties of N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide?
N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide has a molecular weight of 253.39 g/mol, XLogP of 1.44, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[(3Z)-hexa-3,5-dienyl]-propylamino]-2-hydroxypropyl]-N'-methylmethanimidamide is sourced from PubChem (CID 90250575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).