About N-(2-hydroxyethyl)-N'-methylpentanimidamide
N-(2-hydroxyethyl)-N'-methylpentanimidamide (PubChem CID 90250612) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N'-methylpentanimidamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-N'-methylpentanimidamide |
| PubChem CID | 90250612 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N-(2-hydroxyethyl)-N'-methylpentanimidamide |
| SMILES | CCCC/C(=N\C)NCCO |
| InChI | InChI=1S/C8H18N2O/c1-3-4-5-8(9-2)10-6-7-11/h11H,3-7H2,1-2H3,(H,9,10) |
| InChIKey | XDSRJLNRFXBIPR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxyethyl)-N'-methylpentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-N'-methylpentanimidamide?
The IUPAC name of N-(2-hydroxyethyl)-N'-methylpentanimidamide (CID 90250612) is N-(2-hydroxyethyl)-N'-methylpentanimidamide.
What is the SMILES notation for N-(2-hydroxyethyl)-N'-methylpentanimidamide?
The canonical SMILES for N-(2-hydroxyethyl)-N'-methylpentanimidamide is CCCC/C(=N\C)NCCO.
What is the InChIKey of N-(2-hydroxyethyl)-N'-methylpentanimidamide?
The InChIKey is XDSRJLNRFXBIPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-3-4-5-8(9-2)10-6-7-11/h11H,3-7H2,1-2H3,(H,9,10).
What are the key properties of N-(2-hydroxyethyl)-N'-methylpentanimidamide?
N-(2-hydroxyethyl)-N'-methylpentanimidamide has a molecular weight of 158.24 g/mol, XLogP of 0.79, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-N'-methylpentanimidamide is sourced from PubChem (CID 90250612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).