About (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine
(3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine (PubChem CID 90250613) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine.
Molecular Properties
| Compound Name | (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine |
| PubChem CID | 90250613 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine |
| SMILES | C=C/C=C/CCN(C)CC |
| InChI | InChI=1S/C9H17N/c1-4-6-7-8-9-10(3)5-2/h4,6-7H,1,5,8-9H2,2-3H3/b7-6+ |
| InChIKey | DASZBYGECVVRHO-VOTSOKGWSA-N |
| XLogP | 2.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine?
The IUPAC name of (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine (CID 90250613) is (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine.
What is the SMILES notation for (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine?
The canonical SMILES for (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine is C=C/C=C/CCN(C)CC.
What is the InChIKey of (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine?
The InChIKey is DASZBYGECVVRHO-VOTSOKGWSA-N. The full InChI is InChI=1S/C9H17N/c1-4-6-7-8-9-10(3)5-2/h4,6-7H,1,5,8-9H2,2-3H3/b7-6+.
What are the key properties of (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine?
(3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine has a molecular weight of 139.24 g/mol, XLogP of 2.07, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N-ethyl-N-methylhexa-3,5-dien-1-amine is sourced from PubChem (CID 90250613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).