About 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one
2,3-ditert-butyl-6,7-difluoroquinazolin-4-one (PubChem CID 90250791) has the molecular formula C16H20F2N2O
and a molecular weight of 294.35 g/mol. Its IUPAC name is 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one.
Molecular Properties
| Compound Name | 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one |
| PubChem CID | 90250791 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one |
| SMILES | CC(C)(C)c1nc2cc(F)c(F)cc2c(=O)n1C(C)(C)C |
| InChI | InChI=1S/C16H20F2N2O/c1-15(2,3)14-19-12-8-11(18)10(17)7-9(12)13(21)20(14)16(4,5)6/h7-8H,1-6H3 |
| InChIKey | RHMDRMMXYAEVLB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one?
The IUPAC name of 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one (CID 90250791) is 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one.
What is the SMILES notation for 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one?
The canonical SMILES for 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one is CC(C)(C)c1nc2cc(F)c(F)cc2c(=O)n1C(C)(C)C.
What is the InChIKey of 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one?
The InChIKey is RHMDRMMXYAEVLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F2N2O/c1-15(2,3)14-19-12-8-11(18)10(17)7-9(12)13(21)20(14)16(4,5)6/h7-8H,1-6H3.
What are the key properties of 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one?
2,3-ditert-butyl-6,7-difluoroquinazolin-4-one has a molecular weight of 294.35 g/mol, XLogP of 3.73, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-ditert-butyl-6,7-difluoroquinazolin-4-one is sourced from PubChem (CID 90250791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).