About 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene
2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene (PubChem CID 90251011) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene.
Molecular Properties
| Compound Name | 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene |
| PubChem CID | 90251011 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene |
| SMILES | [H]/N=N/CCC1=CC=C(C)CC1 |
| InChI | InChI=1S/C9H14N2/c1-8-2-4-9(5-3-8)6-7-11-10/h2,4,10H,3,5-7H2,1H3/b11-10+ |
| InChIKey | MGDORDLGDHSDOS-ZHACJKMWSA-N |
| XLogP | 3.07 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene?
The IUPAC name of 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene (CID 90251011) is 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene.
What is the SMILES notation for 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene?
The canonical SMILES for 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene is [H]/N=N/CCC1=CC=C(C)CC1.
What is the InChIKey of 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene?
The InChIKey is MGDORDLGDHSDOS-ZHACJKMWSA-N. The full InChI is InChI=1S/C9H14N2/c1-8-2-4-9(5-3-8)6-7-11-10/h2,4,10H,3,5-7H2,1H3/b11-10+.
What are the key properties of 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene?
2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene has a molecular weight of 150.22 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylcyclohexa-1,3-dien-1-yl)ethyldiazene is sourced from PubChem (CID 90251011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).