C39H46N2O12 — CID 90251137
1-[2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-2-morpholin-4-ylethanone (PubChem CID 90251137) has the molecular formula C39H46N2O12 and a molecular weight of 734.80 g/mol. Its IUPAC name is 1-[2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-2-morpholin-4-ylethanone.
| Compound Name | 1-[2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-2-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 90251137 |
| Molecular Formula | C39H46N2O12 |
| Molecular Weight | 734.80 g/mol |
| Exact Mass | 734.31 |
| IUPAC Name | 1-[2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-2-morpholin-4-ylethanone |
| SMILES | O=C(CN1CCOCC1)N1CCC2(CC1)c1cc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)ccc1-c1ccc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc12 |
| InChI | InChI=1S/C39H46N2O12/c42-20-30-35(47)37(49)33(45)28(52-30)7-3-22-1-5-24-25-6-2-23(4-8-29-34(46)38(50)36(48)31(21-43)53-29)18-27(25)39(26(24)17-22)9-11-41(12-10-39)32(44)19-40-13-15-51-16-14-40/h1-2,5-6,17-18,28-31,33-38,42-43,45-50H,9-16,19-21H2/t28-,29-,30-,31-,33-,34-,35-,36-,37-,38-/m1/s1 |
| InChIKey | UEEMTBPHHSBBND-KBPJEYOBSA-N |
| XLogP | -2.70 |
| TPSA | 213.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.80 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|