C38H40N2O11 — CID 90251147
1-[2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-carbonyl]cyclopropane-1-carbonitrile (PubChem CID 90251147) has the molecular formula C38H40N2O11 and a molecular weight of 700.74 g/mol. Its IUPAC name is 1-[2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-carbonyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-carbonyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 90251147 |
| Molecular Formula | C38H40N2O11 |
| Molecular Weight | 700.74 g/mol |
| Exact Mass | 700.26 |
| IUPAC Name | 1-[2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-carbonyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(C(=O)N2CCC3(CC2)c2cc(C#C[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)ccc2-c2ccc(C#C[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)cc23)CC1 |
| InChI | InChI=1S/C38H40N2O11/c39-19-37(9-10-37)36(49)40-13-11-38(12-14-40)24-15-20(3-7-26-30(43)34(47)32(45)28(17-41)50-26)1-5-22(24)23-6-2-21(16-25(23)38)4-8-27-31(44)35(48)33(46)29(18-42)51-27/h1-2,5-6,15-16,26-35,41-48H,9-14,17-18H2/t26-,27-,28-,29-,30-,31-,32-,33-,34-,35-/m1/s1 |
| InChIKey | SOSKAKYNWFKZJG-XFQBFFPDSA-N |
| XLogP | -1.73 |
| TPSA | 224.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.74 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|