C38H43NO11 — CID 90251148
[2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-cyclobutylmethanone (PubChem CID 90251148) has the molecular formula C38H43NO11 and a molecular weight of 689.76 g/mol. Its IUPAC name is [2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-cyclobutylmethanone.
| Compound Name | [2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 90251148 |
| Molecular Formula | C38H43NO11 |
| Molecular Weight | 689.76 g/mol |
| Exact Mass | 689.28 |
| IUPAC Name | [2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1CCC2(CC1)c1cc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)ccc1-c1ccc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc12 |
| InChI | InChI=1S/C38H43NO11/c40-18-29-33(44)35(46)31(42)27(49-29)10-6-20-4-8-23-24-9-5-21(7-11-28-32(43)36(47)34(45)30(19-41)50-28)17-26(24)38(25(23)16-20)12-14-39(15-13-38)37(48)22-2-1-3-22/h4-5,8-9,16-17,22,27-36,40-47H,1-3,12-15,18-19H2/t27-,28-,29-,30-,31-,32-,33-,34-,35-,36-/m1/s1 |
| InChIKey | JEVCIKPDLFJMCI-OCHPSTKGSA-N |
| XLogP | -1.24 |
| TPSA | 200.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.76 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|