About 2,7-dimethyl-3,3a-dihydroindazole
2,7-dimethyl-3,3a-dihydroindazole (PubChem CID 90251212) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,7-dimethyl-3,3a-dihydroindazole.
Molecular Properties
| Compound Name | 2,7-dimethyl-3,3a-dihydroindazole |
| PubChem CID | 90251212 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2,7-dimethyl-3,3a-dihydroindazole |
| SMILES | CC1=CC=CC2CN(C)N=C12 |
| InChI | InChI=1S/C9H12N2/c1-7-4-3-5-8-6-11(2)10-9(7)8/h3-5,8H,6H2,1-2H3 |
| InChIKey | LSSWLLPETPXBFV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-dimethyl-3,3a-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-3,3a-dihydroindazole?
The IUPAC name of 2,7-dimethyl-3,3a-dihydroindazole (CID 90251212) is 2,7-dimethyl-3,3a-dihydroindazole.
What is the SMILES notation for 2,7-dimethyl-3,3a-dihydroindazole?
The canonical SMILES for 2,7-dimethyl-3,3a-dihydroindazole is CC1=CC=CC2CN(C)N=C12.
What is the InChIKey of 2,7-dimethyl-3,3a-dihydroindazole?
The InChIKey is LSSWLLPETPXBFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-7-4-3-5-8-6-11(2)10-9(7)8/h3-5,8H,6H2,1-2H3.
What are the key properties of 2,7-dimethyl-3,3a-dihydroindazole?
2,7-dimethyl-3,3a-dihydroindazole has a molecular weight of 148.21 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-3,3a-dihydroindazole is sourced from PubChem (CID 90251212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).